C18H25NO — CID 784414
N-[(2-methoxyphenyl)methyl]adamantan-2-amine (PubChem CID 784414) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is N-[(2-methoxyphenyl)methyl]adamantan-2-amine.
| Compound Name | N-[(2-methoxyphenyl)methyl]adamantan-2-amine |
|---|---|
| PubChem CID | 784414 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | N-[(2-methoxyphenyl)methyl]adamantan-2-amine |
| SMILES | COc1ccccc1CNC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C18H25NO/c1-20-17-5-3-2-4-14(17)11-19-18-15-7-12-6-13(9-15)10-16(18)8-12/h2-5,12-13,15-16,18-19H,6-11H2,1H3 |
| InChIKey | VHQLASZVOXOLKZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |