C14H13NO6 — CID 7844229
(2-amino-2-oxoethyl) 2-(4-methyl-2-oxochromen-7-yl)oxyacetate (PubChem CID 7844229) has the molecular formula C14H13NO6 and a molecular weight of 291.26 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 2-(4-methyl-2-oxochromen-7-yl)oxyacetate.
| Compound Name | (2-amino-2-oxoethyl) 2-(4-methyl-2-oxochromen-7-yl)oxyacetate |
|---|---|
| PubChem CID | 7844229 |
| Molecular Formula | C14H13NO6 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | (2-amino-2-oxoethyl) 2-(4-methyl-2-oxochromen-7-yl)oxyacetate |
| SMILES | Cc1cc(=O)oc2cc(OCC(=O)OCC(N)=O)ccc12 |
| InChI | InChI=1S/C14H13NO6/c1-8-4-13(17)21-11-5-9(2-3-10(8)11)19-7-14(18)20-6-12(15)16/h2-5H,6-7H2,1H3,(H2,15,16) |
| InChIKey | WYUQADWPFRYCMZ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|