About 2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)acetate
2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)acetate (PubChem CID 78442606) has the molecular formula C6H7O4S-
and a molecular weight of 175.18 g/mol. Its IUPAC name is 2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)acetate.
Molecular Properties
| Compound Name | 2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)acetate |
| PubChem CID | 78442606 |
| Molecular Formula | C6H7O4S- |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.01 |
| IUPAC Name | 2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)acetate |
| SMILES | O=C([O-])CC1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C6H8O4S/c7-6(8)3-5-1-2-11(9,10)4-5/h1-2,5H,3-4H2,(H,7,8)/p-1 |
| InChIKey | SLMDSFRWWIKZCT-UHFFFAOYSA-M |
| XLogP | -1.32 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)acetate?
The IUPAC name of 2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)acetate (CID 78442606) is 2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)acetate.
What is the SMILES notation for 2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)acetate?
The canonical SMILES for 2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)acetate is O=C([O-])CC1C=CS(=O)(=O)C1.
What is the InChIKey of 2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)acetate?
The InChIKey is SLMDSFRWWIKZCT-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H8O4S/c7-6(8)3-5-1-2-11(9,10)4-5/h1-2,5H,3-4H2,(H,7,8)/p-1.
What are the key properties of 2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)acetate?
2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)acetate has a molecular weight of 175.18 g/mol, XLogP of -1.32, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)acetate is sourced from PubChem (CID 78442606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).