C11H7BrCl2N2O — CID 7844651
2-[(2-bromophenyl)methyl]-4,5-dichloropyridazin-3-one (PubChem CID 7844651) has the molecular formula C11H7BrCl2N2O and a molecular weight of 334.00 g/mol. Its IUPAC name is 2-[(2-bromophenyl)methyl]-4,5-dichloropyridazin-3-one.
| Compound Name | 2-[(2-bromophenyl)methyl]-4,5-dichloropyridazin-3-one |
|---|---|
| PubChem CID | 7844651 |
| Molecular Formula | C11H7BrCl2N2O |
| Molecular Weight | 334.00 g/mol |
| Exact Mass | 331.91 |
| IUPAC Name | 2-[(2-bromophenyl)methyl]-4,5-dichloropyridazin-3-one |
| SMILES | O=c1c(Cl)c(Cl)cnn1Cc1ccccc1Br |
| InChI | InChI=1S/C11H7BrCl2N2O/c12-8-4-2-1-3-7(8)6-16-11(17)10(14)9(13)5-15-16/h1-5H,6H2 |
| InChIKey | MNKPNXIKZVUCOV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.00 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |