C20H26N2O6 — CID 7844842
ethyl (4S)-6-[(4-butoxybenzoyl)oxymethyl]-4-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 7844842) has the molecular formula C20H26N2O6 and a molecular weight of 390.44 g/mol. Its IUPAC name is ethyl (4S)-6-[(4-butoxybenzoyl)oxymethyl]-4-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl (4S)-6-[(4-butoxybenzoyl)oxymethyl]-4-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 7844842 |
| Molecular Formula | C20H26N2O6 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | ethyl (4S)-6-[(4-butoxybenzoyl)oxymethyl]-4-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCCCOc1ccc(C(=O)OCC2=C(C(=O)OCC)[C@H](C)NC(=O)N2)cc1 |
| InChI | InChI=1S/C20H26N2O6/c1-4-6-11-27-15-9-7-14(8-10-15)18(23)28-12-16-17(19(24)26-5-2)13(3)21-20(25)22-16/h7-10,13H,4-6,11-12H2,1-3H3,(H2,21,22,25)/t13-/m0/s1 |
| InChIKey | NSPVYTDWEALICM-ZDUSSCGKSA-N |
| XLogP | 2.54 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|