C24H27N3O2S — CID 7845425
2-[3-(3,4-dimethylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-ethyl-N-(2-methylprop-2-enyl)acetamide (PubChem CID 7845425) has the molecular formula C24H27N3O2S and a molecular weight of 421.57 g/mol. Its IUPAC name is 2-[3-(3,4-dimethylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-ethyl-N-(2-methylprop-2-enyl)acetamide.
| Compound Name | 2-[3-(3,4-dimethylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-ethyl-N-(2-methylprop-2-enyl)acetamide |
|---|---|
| PubChem CID | 7845425 |
| Molecular Formula | C24H27N3O2S |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 2-[3-(3,4-dimethylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-ethyl-N-(2-methylprop-2-enyl)acetamide |
| SMILES | C=C(C)CN(CC)C(=O)CSc1nc2ccccc2c(=O)n1-c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C24H27N3O2S/c1-6-26(14-16(2)3)22(28)15-30-24-25-21-10-8-7-9-20(21)23(29)27(24)19-12-11-17(4)18(5)13-19/h7-13H,2,6,14-15H2,1,3-5H3 |
| InChIKey | PNAFHBRLTGTJFH-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|