C17H20N4O — CID 78458052
3-(3,4-dimethylanilino)-6-phenyl-1,2,4-triazinan-5-one (PubChem CID 78458052) has the molecular formula C17H20N4O and a molecular weight of 296.37 g/mol. Its IUPAC name is 3-(3,4-dimethylanilino)-6-phenyl-1,2,4-triazinan-5-one.
| Compound Name | 3-(3,4-dimethylanilino)-6-phenyl-1,2,4-triazinan-5-one |
|---|---|
| PubChem CID | 78458052 |
| Molecular Formula | C17H20N4O |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 3-(3,4-dimethylanilino)-6-phenyl-1,2,4-triazinan-5-one |
| SMILES | Cc1ccc(NC2NNC(c3ccccc3)C(=O)N2)cc1C |
| InChI | InChI=1S/C17H20N4O/c1-11-8-9-14(10-12(11)2)18-17-19-16(22)15(20-21-17)13-6-4-3-5-7-13/h3-10,15,17-18,20-21H,1-2H3,(H,19,22) |
| InChIKey | YKZHGFIMTWEYRO-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |