C15H19N2O5S+ — CID 78459641
(2,3,5-trimethylphenyl) 1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-sulfonate (PubChem CID 78459641) has the molecular formula C15H19N2O5S+ and a molecular weight of 339.39 g/mol. Its IUPAC name is (2,3,5-trimethylphenyl) 1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-sulfonate.
| Compound Name | (2,3,5-trimethylphenyl) 1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-sulfonate |
|---|---|
| PubChem CID | 78459641 |
| Molecular Formula | C15H19N2O5S+ |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | (2,3,5-trimethylphenyl) 1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-sulfonate |
| SMILES | Cc1cc(C)c(C)c(OS(=O)(=O)C2C=[N+](C)C(=O)N(C)C2=O)c1 |
| InChI | InChI=1S/C15H19N2O5S/c1-9-6-10(2)11(3)12(7-9)22-23(20,21)13-8-16(4)15(19)17(5)14(13)18/h6-8,13H,1-5H3/q+1 |
| InChIKey | CYDNTZTXPONLHO-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|