C16H16N2O5S — CID 78459645
naphthalen-1-yl 1,3-dimethyl-2,4-dioxo-1,3-diazinane-5-sulfonate (PubChem CID 78459645) has the molecular formula C16H16N2O5S and a molecular weight of 348.38 g/mol. Its IUPAC name is naphthalen-1-yl 1,3-dimethyl-2,4-dioxo-1,3-diazinane-5-sulfonate.
| Compound Name | naphthalen-1-yl 1,3-dimethyl-2,4-dioxo-1,3-diazinane-5-sulfonate |
|---|---|
| PubChem CID | 78459645 |
| Molecular Formula | C16H16N2O5S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | naphthalen-1-yl 1,3-dimethyl-2,4-dioxo-1,3-diazinane-5-sulfonate |
| SMILES | CN1CC(S(=O)(=O)Oc2cccc3ccccc23)C(=O)N(C)C1=O |
| InChI | InChI=1S/C16H16N2O5S/c1-17-10-14(15(19)18(2)16(17)20)24(21,22)23-13-9-5-7-11-6-3-4-8-12(11)13/h3-9,14H,10H2,1-2H3 |
| InChIKey | MHYWMOKIKVHIOI-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|