C14H17N2O5S+ — CID 78459650
(3,4-dimethylphenyl) 1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-sulfonate (PubChem CID 78459650) has the molecular formula C14H17N2O5S+ and a molecular weight of 325.37 g/mol. Its IUPAC name is (3,4-dimethylphenyl) 1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-sulfonate.
| Compound Name | (3,4-dimethylphenyl) 1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-sulfonate |
|---|---|
| PubChem CID | 78459650 |
| Molecular Formula | C14H17N2O5S+ |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | (3,4-dimethylphenyl) 1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-sulfonate |
| SMILES | Cc1ccc(OS(=O)(=O)C2C=[N+](C)C(=O)N(C)C2=O)cc1C |
| InChI | InChI=1S/C14H17N2O5S/c1-9-5-6-11(7-10(9)2)21-22(19,20)12-8-15(3)14(18)16(4)13(12)17/h5-8,12H,1-4H3/q+1 |
| InChIKey | JWMDRAXPCVHTAM-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|