C17H32N2 — CID 784637
N-(2-adamantyl)-N',N',2,2-tetramethylpropane-1,3-diamine (PubChem CID 784637) has the molecular formula C17H32N2 and a molecular weight of 264.46 g/mol. Its IUPAC name is N-(2-adamantyl)-N',N',2,2-tetramethylpropane-1,3-diamine.
| Compound Name | N-(2-adamantyl)-N',N',2,2-tetramethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 784637 |
| Molecular Formula | C17H32N2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.26 |
| IUPAC Name | N-(2-adamantyl)-N',N',2,2-tetramethylpropane-1,3-diamine |
| SMILES | CN(C)CC(C)(C)CNC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C17H32N2/c1-17(2,11-19(3)4)10-18-16-14-6-12-5-13(8-14)9-15(16)7-12/h12-16,18H,5-11H2,1-4H3 |
| InChIKey | XTEMEOMVCBTCNK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |