C18H14BrNO3S — CID 7847035
[2-(3-bromophenyl)-2-oxoethyl] 3-(1,3-benzothiazol-2-yl)propanoate (PubChem CID 7847035) has the molecular formula C18H14BrNO3S and a molecular weight of 404.29 g/mol. Its IUPAC name is [2-(3-bromophenyl)-2-oxoethyl] 3-(1,3-benzothiazol-2-yl)propanoate.
| Compound Name | [2-(3-bromophenyl)-2-oxoethyl] 3-(1,3-benzothiazol-2-yl)propanoate |
|---|---|
| PubChem CID | 7847035 |
| Molecular Formula | C18H14BrNO3S |
| Molecular Weight | 404.29 g/mol |
| Exact Mass | 402.99 |
| IUPAC Name | [2-(3-bromophenyl)-2-oxoethyl] 3-(1,3-benzothiazol-2-yl)propanoate |
| SMILES | O=C(CCc1nc2ccccc2s1)OCC(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C18H14BrNO3S/c19-13-5-3-4-12(10-13)15(21)11-23-18(22)9-8-17-20-14-6-1-2-7-16(14)24-17/h1-7,10H,8-9,11H2 |
| InChIKey | KBGSXUZFEGIIJG-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.29 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |