C15H20ClNO4 — CID 7847240
[2-[[(2S)-3-methylbutan-2-yl]amino]-2-oxoethyl] 2-(2-chlorophenoxy)acetate (PubChem CID 7847240) has the molecular formula C15H20ClNO4 and a molecular weight of 313.78 g/mol. Its IUPAC name is [2-[[(2S)-3-methylbutan-2-yl]amino]-2-oxoethyl] 2-(2-chlorophenoxy)acetate.
| Compound Name | [2-[[(2S)-3-methylbutan-2-yl]amino]-2-oxoethyl] 2-(2-chlorophenoxy)acetate |
|---|---|
| PubChem CID | 7847240 |
| Molecular Formula | C15H20ClNO4 |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | [2-[[(2S)-3-methylbutan-2-yl]amino]-2-oxoethyl] 2-(2-chlorophenoxy)acetate |
| SMILES | CC(C)[C@H](C)NC(=O)COC(=O)COc1ccccc1Cl |
| InChI | InChI=1S/C15H20ClNO4/c1-10(2)11(3)17-14(18)8-21-15(19)9-20-13-7-5-4-6-12(13)16/h4-7,10-11H,8-9H2,1-3H3,(H,17,18)/t11-/m0/s1 |
| InChIKey | YLMKBJYTBCNGOZ-NSHDSACASA-N |
| XLogP | 2.42 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |