C21H26N2O2S — CID 7847490
4-[[2-(4-tert-butylphenyl)sulfanylacetyl]amino]-N,N-dimethylbenzamide (PubChem CID 7847490) has the molecular formula C21H26N2O2S and a molecular weight of 370.52 g/mol. Its IUPAC name is 4-[[2-(4-tert-butylphenyl)sulfanylacetyl]amino]-N,N-dimethylbenzamide.
| Compound Name | 4-[[2-(4-tert-butylphenyl)sulfanylacetyl]amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 7847490 |
| Molecular Formula | C21H26N2O2S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 4-[[2-(4-tert-butylphenyl)sulfanylacetyl]amino]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(NC(=O)CSc2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C21H26N2O2S/c1-21(2,3)16-8-12-18(13-9-16)26-14-19(24)22-17-10-6-15(7-11-17)20(25)23(4)5/h6-13H,14H2,1-5H3,(H,22,24) |
| InChIKey | KGPLHNLYROMXAT-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |