C22H24ClN3O3 — CID 78481807
2-chloro-1-[2-methyl-4-[6-[(2-methylphenyl)methyl]furo[2,3-b]pyrrole-5-carbonyl]piperazin-1-yl]ethanone (PubChem CID 78481807) has the molecular formula C22H24ClN3O3 and a molecular weight of 413.91 g/mol. Its IUPAC name is 2-chloro-1-[2-methyl-4-[6-[(2-methylphenyl)methyl]furo[2,3-b]pyrrole-5-carbonyl]piperazin-1-yl]ethanone.
| Compound Name | 2-chloro-1-[2-methyl-4-[6-[(2-methylphenyl)methyl]furo[2,3-b]pyrrole-5-carbonyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 78481807 |
| Molecular Formula | C22H24ClN3O3 |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 2-chloro-1-[2-methyl-4-[6-[(2-methylphenyl)methyl]furo[2,3-b]pyrrole-5-carbonyl]piperazin-1-yl]ethanone |
| SMILES | Cc1ccccc1Cn1c(C(=O)N2CCN(C(=O)CCl)C(C)C2)cc2ccoc21 |
| InChI | InChI=1S/C22H24ClN3O3/c1-15-5-3-4-6-18(15)14-26-19(11-17-7-10-29-22(17)26)21(28)24-8-9-25(16(2)13-24)20(27)12-23/h3-7,10-11,16H,8-9,12-14H2,1-2H3 |
| InChIKey | VFCMSLWBWVMMTI-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 58.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|