C20H29N5O3S — CID 78488298
2-[[1,3-dimethyl-7-(2-methylphenyl)-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl]sulfanyl]-N-propan-2-ylacetamide (PubChem CID 78488298) has the molecular formula C20H29N5O3S and a molecular weight of 419.55 g/mol. Its IUPAC name is 2-[[1,3-dimethyl-7-(2-methylphenyl)-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl]sulfanyl]-N-propan-2-ylacetamide.
| Compound Name | 2-[[1,3-dimethyl-7-(2-methylphenyl)-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl]sulfanyl]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 78488298 |
| Molecular Formula | C20H29N5O3S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 2-[[1,3-dimethyl-7-(2-methylphenyl)-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl]sulfanyl]-N-propan-2-ylacetamide |
| SMILES | Cc1ccccc1C1NC(SCC(=O)NC(C)C)C2C(=O)N(C)C(=O)N(C)C2N1 |
| InChI | InChI=1S/C20H29N5O3S/c1-11(2)21-14(26)10-29-18-15-17(24(4)20(28)25(5)19(15)27)22-16(23-18)13-9-7-6-8-12(13)3/h6-9,11,15-18,22-23H,10H2,1-5H3,(H,21,26) |
| InChIKey | QQWDYQJBNJYTRR-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |