C16H24N4O3S — CID 78490248
N-(4-amino-6-oxo-2-propylsulfanyl-1,3-diazinan-5-yl)-4-ethoxybenzamide (PubChem CID 78490248) has the molecular formula C16H24N4O3S and a molecular weight of 352.46 g/mol. Its IUPAC name is N-(4-amino-6-oxo-2-propylsulfanyl-1,3-diazinan-5-yl)-4-ethoxybenzamide.
| Compound Name | N-(4-amino-6-oxo-2-propylsulfanyl-1,3-diazinan-5-yl)-4-ethoxybenzamide |
|---|---|
| PubChem CID | 78490248 |
| Molecular Formula | C16H24N4O3S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | N-(4-amino-6-oxo-2-propylsulfanyl-1,3-diazinan-5-yl)-4-ethoxybenzamide |
| SMILES | CCCSC1NC(=O)C(NC(=O)c2ccc(OCC)cc2)C(N)N1 |
| InChI | InChI=1S/C16H24N4O3S/c1-3-9-24-16-19-13(17)12(15(22)20-16)18-14(21)10-5-7-11(8-6-10)23-4-2/h5-8,12-13,16,19H,3-4,9,17H2,1-2H3,(H,18,21)(H,20,22) |
| InChIKey | RIOUFKUUUJVSFE-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |