About 6-methyl-7-[(2-methylphenyl)methyl]imidazo[2,1-b][1,3]thiazol-4-ium
6-methyl-7-[(2-methylphenyl)methyl]imidazo[2,1-b][1,3]thiazol-4-ium (PubChem CID 785032) has the molecular formula C14H15N2S+
and a molecular weight of 243.36 g/mol. Its IUPAC name is 6-methyl-7-[(2-methylphenyl)methyl]imidazo[2,1-b][1,3]thiazol-4-ium.
Molecular Properties
| Compound Name | 6-methyl-7-[(2-methylphenyl)methyl]imidazo[2,1-b][1,3]thiazol-4-ium |
| PubChem CID | 785032 |
| Molecular Formula | C14H15N2S+ |
| Molecular Weight | 243.36 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 6-methyl-7-[(2-methylphenyl)methyl]imidazo[2,1-b][1,3]thiazol-4-ium |
| SMILES | Cc1ccccc1Cn1c(C)c[n+]2ccsc12 |
| InChI | InChI=1S/C14H15N2S/c1-11-5-3-4-6-13(11)10-16-12(2)9-15-7-8-17-14(15)16/h3-9H,10H2,1-2H3/q+1 |
| InChIKey | FDCMFKDWPYNTEX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 9.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-7-[(2-methylphenyl)methyl]imidazo[2,1-b][1,3]thiazol-4-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-7-[(2-methylphenyl)methyl]imidazo[2,1-b][1,3]thiazol-4-ium?
The IUPAC name of 6-methyl-7-[(2-methylphenyl)methyl]imidazo[2,1-b][1,3]thiazol-4-ium (CID 785032) is 6-methyl-7-[(2-methylphenyl)methyl]imidazo[2,1-b][1,3]thiazol-4-ium.
What is the SMILES notation for 6-methyl-7-[(2-methylphenyl)methyl]imidazo[2,1-b][1,3]thiazol-4-ium?
The canonical SMILES for 6-methyl-7-[(2-methylphenyl)methyl]imidazo[2,1-b][1,3]thiazol-4-ium is Cc1ccccc1Cn1c(C)c[n+]2ccsc12.
What is the InChIKey of 6-methyl-7-[(2-methylphenyl)methyl]imidazo[2,1-b][1,3]thiazol-4-ium?
The InChIKey is FDCMFKDWPYNTEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N2S/c1-11-5-3-4-6-13(11)10-16-12(2)9-15-7-8-17-14(15)16/h3-9H,10H2,1-2H3/q+1.
What are the key properties of 6-methyl-7-[(2-methylphenyl)methyl]imidazo[2,1-b][1,3]thiazol-4-ium?
6-methyl-7-[(2-methylphenyl)methyl]imidazo[2,1-b][1,3]thiazol-4-ium has a molecular weight of 243.36 g/mol, XLogP of 2.95, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-7-[(2-methylphenyl)methyl]imidazo[2,1-b][1,3]thiazol-4-ium is sourced from PubChem (CID 785032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).