C19H28N5O2+ — CID 78508191
6-cyclopentyl-4,7-dimethyl-2-(3-methylbutyl)-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione (PubChem CID 78508191) has the molecular formula C19H28N5O2+ and a molecular weight of 358.47 g/mol. Its IUPAC name is 6-cyclopentyl-4,7-dimethyl-2-(3-methylbutyl)-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione.
| Compound Name | 6-cyclopentyl-4,7-dimethyl-2-(3-methylbutyl)-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione |
|---|---|
| PubChem CID | 78508191 |
| Molecular Formula | C19H28N5O2+ |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | 6-cyclopentyl-4,7-dimethyl-2-(3-methylbutyl)-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione |
| SMILES | Cc1c[n+]2c(n1C1CCCC1)N=C1C2C(=O)N(CCC(C)C)C(=O)N1C |
| InChI | InChI=1S/C19H28N5O2/c1-12(2)9-10-22-17(25)15-16(21(4)19(22)26)20-18-23(15)11-13(3)24(18)14-7-5-6-8-14/h11-12,14-15H,5-10H2,1-4H3/q+1 |
| InChIKey | NJYFZLYTPAHDEA-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 61.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|