C17H11F2NO5 — CID 7852555
[2-(3,4-difluorophenyl)-2-oxoethyl] (E)-3-(4-nitrophenyl)prop-2-enoate (PubChem CID 7852555) has the molecular formula C17H11F2NO5 and a molecular weight of 347.27 g/mol. Its IUPAC name is [2-(3,4-difluorophenyl)-2-oxoethyl] (E)-3-(4-nitrophenyl)prop-2-enoate.
| Compound Name | [2-(3,4-difluorophenyl)-2-oxoethyl] (E)-3-(4-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7852555 |
| Molecular Formula | C17H11F2NO5 |
| Molecular Weight | 347.27 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | [2-(3,4-difluorophenyl)-2-oxoethyl] (E)-3-(4-nitrophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])cc1)OCC(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H11F2NO5/c18-14-7-4-12(9-15(14)19)16(21)10-25-17(22)8-3-11-1-5-13(6-2-11)20(23)24/h1-9H,10H2/b8-3+ |
| InChIKey | IQUVJWZHHIATNK-FPYGCLRLSA-N |
| XLogP | 3.31 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.27 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|