C19H21N5S — CID 78529981
4-[(3-benzylsulfanyl-5-methyl-1,2,4-triazol-4-yl)iminomethyl]-N,N-dimethylaniline (PubChem CID 78529981) has the molecular formula C19H21N5S and a molecular weight of 351.48 g/mol. Its IUPAC name is 4-[(3-benzylsulfanyl-5-methyl-1,2,4-triazol-4-yl)iminomethyl]-N,N-dimethylaniline.
| Compound Name | 4-[(3-benzylsulfanyl-5-methyl-1,2,4-triazol-4-yl)iminomethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 78529981 |
| Molecular Formula | C19H21N5S |
| Molecular Weight | 351.48 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 4-[(3-benzylsulfanyl-5-methyl-1,2,4-triazol-4-yl)iminomethyl]-N,N-dimethylaniline |
| SMILES | Cc1nnc(SCc2ccccc2)n1N=Cc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C19H21N5S/c1-15-21-22-19(25-14-17-7-5-4-6-8-17)24(15)20-13-16-9-11-18(12-10-16)23(2)3/h4-13H,14H2,1-3H3 |
| InChIKey | RGYIJUWTPKXWFV-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 46.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|