About 2-chloro-N-(1,3,5-trimethylpyrazol-4-yl)acetamide
2-chloro-N-(1,3,5-trimethylpyrazol-4-yl)acetamide (PubChem CID 785309) has the molecular formula C8H12ClN3O
and a molecular weight of 201.66 g/mol. Its IUPAC name is 2-chloro-N-(1,3,5-trimethylpyrazol-4-yl)acetamide.
Molecular Properties
| Compound Name | 2-chloro-N-(1,3,5-trimethylpyrazol-4-yl)acetamide |
| PubChem CID | 785309 |
| Molecular Formula | C8H12ClN3O |
| Molecular Weight | 201.66 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | 2-chloro-N-(1,3,5-trimethylpyrazol-4-yl)acetamide |
| SMILES | Cc1nn(C)c(C)c1NC(=O)CCl |
| InChI | InChI=1S/C8H12ClN3O/c1-5-8(10-7(13)4-9)6(2)12(3)11-5/h4H2,1-3H3,(H,10,13) |
| InChIKey | FTJPNEYQAUHDTG-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.66 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-(1,3,5-trimethylpyrazol-4-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-(1,3,5-trimethylpyrazol-4-yl)acetamide?
The IUPAC name of 2-chloro-N-(1,3,5-trimethylpyrazol-4-yl)acetamide (CID 785309) is 2-chloro-N-(1,3,5-trimethylpyrazol-4-yl)acetamide.
What is the SMILES notation for 2-chloro-N-(1,3,5-trimethylpyrazol-4-yl)acetamide?
The canonical SMILES for 2-chloro-N-(1,3,5-trimethylpyrazol-4-yl)acetamide is Cc1nn(C)c(C)c1NC(=O)CCl.
What is the InChIKey of 2-chloro-N-(1,3,5-trimethylpyrazol-4-yl)acetamide?
The InChIKey is FTJPNEYQAUHDTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12ClN3O/c1-5-8(10-7(13)4-9)6(2)12(3)11-5/h4H2,1-3H3,(H,10,13).
What are the key properties of 2-chloro-N-(1,3,5-trimethylpyrazol-4-yl)acetamide?
2-chloro-N-(1,3,5-trimethylpyrazol-4-yl)acetamide has a molecular weight of 201.66 g/mol, XLogP of 1.21, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-(1,3,5-trimethylpyrazol-4-yl)acetamide is sourced from PubChem (CID 785309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).