About methyl 2-(3,4-dimethylanilino)acetate
methyl 2-(3,4-dimethylanilino)acetate (PubChem CID 785322) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is methyl 2-(3,4-dimethylanilino)acetate.
Molecular Properties
| Compound Name | methyl 2-(3,4-dimethylanilino)acetate |
| PubChem CID | 785322 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | methyl 2-(3,4-dimethylanilino)acetate |
| SMILES | COC(=O)CNc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C11H15NO2/c1-8-4-5-10(6-9(8)2)12-7-11(13)14-3/h4-6,12H,7H2,1-3H3 |
| InChIKey | QTOKSMSEWAUPCX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-(3,4-dimethylanilino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(3,4-dimethylanilino)acetate?
The IUPAC name of methyl 2-(3,4-dimethylanilino)acetate (CID 785322) is methyl 2-(3,4-dimethylanilino)acetate.
What is the SMILES notation for methyl 2-(3,4-dimethylanilino)acetate?
The canonical SMILES for methyl 2-(3,4-dimethylanilino)acetate is COC(=O)CNc1ccc(C)c(C)c1.
What is the InChIKey of methyl 2-(3,4-dimethylanilino)acetate?
The InChIKey is QTOKSMSEWAUPCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2/c1-8-4-5-10(6-9(8)2)12-7-11(13)14-3/h4-6,12H,7H2,1-3H3.
What are the key properties of methyl 2-(3,4-dimethylanilino)acetate?
methyl 2-(3,4-dimethylanilino)acetate has a molecular weight of 193.25 g/mol, XLogP of 1.89, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3,4-dimethylanilino)acetate is sourced from PubChem (CID 785322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).