About 2-diphenylphosphoryl-N,N-diethylethanamine
2-diphenylphosphoryl-N,N-diethylethanamine (PubChem CID 785453) has the molecular formula C18H24NOP
and a molecular weight of 301.37 g/mol. Its IUPAC name is 2-diphenylphosphoryl-N,N-diethylethanamine.
Molecular Properties
| Compound Name | 2-diphenylphosphoryl-N,N-diethylethanamine |
| PubChem CID | 785453 |
| Molecular Formula | C18H24NOP |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 2-diphenylphosphoryl-N,N-diethylethanamine |
| SMILES | CCN(CC)CCP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H24NOP/c1-3-19(4-2)15-16-21(20,17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14H,3-4,15-16H2,1-2H3 |
| InChIKey | DRWZABOPWAFOBK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-diphenylphosphoryl-N,N-diethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-diphenylphosphoryl-N,N-diethylethanamine?
The IUPAC name of 2-diphenylphosphoryl-N,N-diethylethanamine (CID 785453) is 2-diphenylphosphoryl-N,N-diethylethanamine.
What is the SMILES notation for 2-diphenylphosphoryl-N,N-diethylethanamine?
The canonical SMILES for 2-diphenylphosphoryl-N,N-diethylethanamine is CCN(CC)CCP(=O)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-diphenylphosphoryl-N,N-diethylethanamine?
The InChIKey is DRWZABOPWAFOBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24NOP/c1-3-19(4-2)15-16-21(20,17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14H,3-4,15-16H2,1-2H3.
What are the key properties of 2-diphenylphosphoryl-N,N-diethylethanamine?
2-diphenylphosphoryl-N,N-diethylethanamine has a molecular weight of 301.37 g/mol, XLogP of 3.34, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-diphenylphosphoryl-N,N-diethylethanamine is sourced from PubChem (CID 785453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).