C24H22N4OS — CID 78551929
N-benzyl-2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]propanamide (PubChem CID 78551929) has the molecular formula C24H22N4OS and a molecular weight of 414.53 g/mol. Its IUPAC name is N-benzyl-2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]propanamide.
| Compound Name | N-benzyl-2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 78551929 |
| Molecular Formula | C24H22N4OS |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | N-benzyl-2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
| SMILES | CC(Sc1nnc(-c2ccccc2)n1-c1ccccc1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C24H22N4OS/c1-18(23(29)25-17-19-11-5-2-6-12-19)30-24-27-26-22(20-13-7-3-8-14-20)28(24)21-15-9-4-10-16-21/h2-16,18H,17H2,1H3,(H,25,29) |
| InChIKey | JBYXEFRLSDGVSM-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |