About 5-(diethylamino)-2-[(2,4-dimethylphenyl)iminomethyl]phenol
5-(diethylamino)-2-[(2,4-dimethylphenyl)iminomethyl]phenol (PubChem CID 785653) has the molecular formula C19H24N2O
and a molecular weight of 296.41 g/mol. Its IUPAC name is 5-(diethylamino)-2-[(2,4-dimethylphenyl)iminomethyl]phenol.
Molecular Properties
| Compound Name | 5-(diethylamino)-2-[(2,4-dimethylphenyl)iminomethyl]phenol |
| PubChem CID | 785653 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 5-(diethylamino)-2-[(2,4-dimethylphenyl)iminomethyl]phenol |
| SMILES | CCN(CC)c1ccc(/C=N/c2ccc(C)cc2C)c(O)c1 |
| InChI | InChI=1S/C19H24N2O/c1-5-21(6-2)17-9-8-16(19(22)12-17)13-20-18-10-7-14(3)11-15(18)4/h7-13,22H,5-6H2,1-4H3/b20-13+ |
| InChIKey | SSUBZVOLPSPUEQ-DEDYPNTBSA-N |
| XLogP | 4.61 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-(diethylamino)-2-[(2,4-dimethylphenyl)iminomethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(diethylamino)-2-[(2,4-dimethylphenyl)iminomethyl]phenol?
The IUPAC name of 5-(diethylamino)-2-[(2,4-dimethylphenyl)iminomethyl]phenol (CID 785653) is 5-(diethylamino)-2-[(2,4-dimethylphenyl)iminomethyl]phenol.
What is the SMILES notation for 5-(diethylamino)-2-[(2,4-dimethylphenyl)iminomethyl]phenol?
The canonical SMILES for 5-(diethylamino)-2-[(2,4-dimethylphenyl)iminomethyl]phenol is CCN(CC)c1ccc(/C=N/c2ccc(C)cc2C)c(O)c1.
What is the InChIKey of 5-(diethylamino)-2-[(2,4-dimethylphenyl)iminomethyl]phenol?
The InChIKey is SSUBZVOLPSPUEQ-DEDYPNTBSA-N. The full InChI is InChI=1S/C19H24N2O/c1-5-21(6-2)17-9-8-16(19(22)12-17)13-20-18-10-7-14(3)11-15(18)4/h7-13,22H,5-6H2,1-4H3/b20-13+.
What are the key properties of 5-(diethylamino)-2-[(2,4-dimethylphenyl)iminomethyl]phenol?
5-(diethylamino)-2-[(2,4-dimethylphenyl)iminomethyl]phenol has a molecular weight of 296.41 g/mol, XLogP of 4.61, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(diethylamino)-2-[(2,4-dimethylphenyl)iminomethyl]phenol is sourced from PubChem (CID 785653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).