About 5-N-phenyltetrazole-1,5-diamine
5-N-phenyltetrazole-1,5-diamine (PubChem CID 785709) has the molecular formula C7H8N6
and a molecular weight of 176.18 g/mol. Its IUPAC name is 5-N-phenyltetrazole-1,5-diamine.
Molecular Properties
| Compound Name | 5-N-phenyltetrazole-1,5-diamine |
| PubChem CID | 785709 |
| Molecular Formula | C7H8N6 |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 5-N-phenyltetrazole-1,5-diamine |
| SMILES | Nn1nnnc1Nc1ccccc1 |
| InChI | InChI=1S/C7H8N6/c8-13-7(10-11-12-13)9-6-4-2-1-3-5-6/h1-5H,8H2,(H,9,10,12) |
| InChIKey | SFOKIBXOKFIPKT-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-N-phenyltetrazole-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-N-phenyltetrazole-1,5-diamine?
The IUPAC name of 5-N-phenyltetrazole-1,5-diamine (CID 785709) is 5-N-phenyltetrazole-1,5-diamine.
What is the SMILES notation for 5-N-phenyltetrazole-1,5-diamine?
The canonical SMILES for 5-N-phenyltetrazole-1,5-diamine is Nn1nnnc1Nc1ccccc1.
What is the InChIKey of 5-N-phenyltetrazole-1,5-diamine?
The InChIKey is SFOKIBXOKFIPKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N6/c8-13-7(10-11-12-13)9-6-4-2-1-3-5-6/h1-5H,8H2,(H,9,10,12).
What are the key properties of 5-N-phenyltetrazole-1,5-diamine?
5-N-phenyltetrazole-1,5-diamine has a molecular weight of 176.18 g/mol, XLogP of 0.13, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-N-phenyltetrazole-1,5-diamine is sourced from PubChem (CID 785709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).