C21H25F2NO3 — CID 78573727
N-(1-adamantyl)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enamide (PubChem CID 78573727) has the molecular formula C21H25F2NO3 and a molecular weight of 377.43 g/mol. Its IUPAC name is N-(1-adamantyl)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enamide.
| Compound Name | N-(1-adamantyl)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 78573727 |
| Molecular Formula | C21H25F2NO3 |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | N-(1-adamantyl)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enamide |
| SMILES | COc1cc(C=CC(=O)NC23CC4CC(CC(C4)C2)C3)ccc1OC(F)F |
| InChI | InChI=1S/C21H25F2NO3/c1-26-18-9-13(2-4-17(18)27-20(22)23)3-5-19(25)24-21-10-14-6-15(11-21)8-16(7-14)12-21/h2-5,9,14-16,20H,6-8,10-12H2,1H3,(H,24,25) |
| InChIKey | OUNWTYIWPWHWAJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|