C16H9Cl2FN2O — CID 78575259
2-cyano-3-(3,4-dichlorophenyl)-N-(2-fluorophenyl)prop-2-enamide (PubChem CID 78575259) has the molecular formula C16H9Cl2FN2O and a molecular weight of 335.17 g/mol. Its IUPAC name is 2-cyano-3-(3,4-dichlorophenyl)-N-(2-fluorophenyl)prop-2-enamide.
| Compound Name | 2-cyano-3-(3,4-dichlorophenyl)-N-(2-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 78575259 |
| Molecular Formula | C16H9Cl2FN2O |
| Molecular Weight | 335.17 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | 2-cyano-3-(3,4-dichlorophenyl)-N-(2-fluorophenyl)prop-2-enamide |
| SMILES | N#CC(=Cc1ccc(Cl)c(Cl)c1)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C16H9Cl2FN2O/c17-12-6-5-10(8-13(12)18)7-11(9-20)16(22)21-15-4-2-1-3-14(15)19/h1-8H,(H,21,22) |
| InChIKey | SYZDJJFVISZMPF-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.17 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|