C23H20N2O5 — CID 7857692
[(2R)-1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 2-anilinobenzoate (PubChem CID 7857692) has the molecular formula C23H20N2O5 and a molecular weight of 404.42 g/mol. Its IUPAC name is [(2R)-1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 2-anilinobenzoate.
| Compound Name | [(2R)-1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 2-anilinobenzoate |
|---|---|
| PubChem CID | 7857692 |
| Molecular Formula | C23H20N2O5 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | [(2R)-1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 2-anilinobenzoate |
| SMILES | C[C@@H](OC(=O)c1ccccc1Nc1ccccc1)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H20N2O5/c1-15(22(26)25-17-11-12-20-21(13-17)29-14-28-20)30-23(27)18-9-5-6-10-19(18)24-16-7-3-2-4-8-16/h2-13,15,24H,14H2,1H3,(H,25,26)/t15-/m1/s1 |
| InChIKey | DQNALAWWFVOYOZ-OAHLLOKOSA-N |
| XLogP | 4.34 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |