C23H18Cl2N3O4+ — CID 78577727
2-(2,3-dichlorophenyl)-17-hydroxy-7-(2-methoxyethyl)-5,7-diaza-9-azoniatetracyclo[8.7.0.03,8.011,16]heptadeca-1(17),3(8),9,11,13,15-hexaene-4,6-dione (PubChem CID 78577727) has the molecular formula C23H18Cl2N3O4+ and a molecular weight of 471.32 g/mol. Its IUPAC name is 2-(2,3-dichlorophenyl)-17-hydroxy-7-(2-methoxyethyl)-5,7-diaza-9-azoniatetracyclo[8.7.0.03,8.011,16]heptadeca-1(17),3(8),9,11,13,15-hexaene-4,6-dione.
| Compound Name | 2-(2,3-dichlorophenyl)-17-hydroxy-7-(2-methoxyethyl)-5,7-diaza-9-azoniatetracyclo[8.7.0.03,8.011,16]heptadeca-1(17),3(8),9,11,13,15-hexaene-4,6-dione |
|---|---|
| PubChem CID | 78577727 |
| Molecular Formula | C23H18Cl2N3O4+ |
| Molecular Weight | 471.32 g/mol |
| Exact Mass | 470.07 |
| IUPAC Name | 2-(2,3-dichlorophenyl)-17-hydroxy-7-(2-methoxyethyl)-5,7-diaza-9-azoniatetracyclo[8.7.0.03,8.011,16]heptadeca-1(17),3(8),9,11,13,15-hexaene-4,6-dione |
| SMILES | COCCn1c2c(c(=O)[nH]c1=O)C(c1cccc(Cl)c1Cl)C1=C(O)c3ccccc3C1=[NH+]2 |
| InChI | InChI=1S/C23H17Cl2N3O4/c1-32-10-9-28-21-17(22(30)27-23(28)31)15(13-7-4-8-14(24)18(13)25)16-19(26-21)11-5-2-3-6-12(11)20(16)29/h2-8,15,29H,9-10H2,1H3,(H,27,30,31)/p+1 |
| InChIKey | UJDCJKDMWHAQKJ-UHFFFAOYSA-O |
| XLogP | 2.12 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |