C23H20N3O4+ — CID 78577751
2-(4-ethoxyphenyl)-17-hydroxy-7-methyl-5,7-diaza-9-azoniatetracyclo[8.7.0.03,8.011,16]heptadeca-1(17),3(8),9,11,13,15-hexaene-4,6-dione (PubChem CID 78577751) has the molecular formula C23H20N3O4+ and a molecular weight of 402.43 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-17-hydroxy-7-methyl-5,7-diaza-9-azoniatetracyclo[8.7.0.03,8.011,16]heptadeca-1(17),3(8),9,11,13,15-hexaene-4,6-dione.
| Compound Name | 2-(4-ethoxyphenyl)-17-hydroxy-7-methyl-5,7-diaza-9-azoniatetracyclo[8.7.0.03,8.011,16]heptadeca-1(17),3(8),9,11,13,15-hexaene-4,6-dione |
|---|---|
| PubChem CID | 78577751 |
| Molecular Formula | C23H20N3O4+ |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 2-(4-ethoxyphenyl)-17-hydroxy-7-methyl-5,7-diaza-9-azoniatetracyclo[8.7.0.03,8.011,16]heptadeca-1(17),3(8),9,11,13,15-hexaene-4,6-dione |
| SMILES | CCOc1ccc(C2C3=C(O)c4ccccc4C3=[NH+]c3c2c(=O)[nH]c(=O)n3C)cc1 |
| InChI | InChI=1S/C23H19N3O4/c1-3-30-13-10-8-12(9-11-13)16-17-19(14-6-4-5-7-15(14)20(17)27)24-21-18(16)22(28)25-23(29)26(21)2/h4-11,16,27H,3H2,1-2H3,(H,25,28,29)/p+1 |
| InChIKey | ZQMBDXXJUZXJLR-UHFFFAOYSA-O |
| XLogP | 1.10 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |