C21H15N4O5+ — CID 78577815
17-hydroxy-7-methyl-2-(4-nitrophenyl)-5,7-diaza-9-azoniatetracyclo[8.7.0.03,8.011,16]heptadeca-1(17),3(8),9,11,13,15-hexaene-4,6-dione (PubChem CID 78577815) has the molecular formula C21H15N4O5+ and a molecular weight of 403.37 g/mol. Its IUPAC name is 17-hydroxy-7-methyl-2-(4-nitrophenyl)-5,7-diaza-9-azoniatetracyclo[8.7.0.03,8.011,16]heptadeca-1(17),3(8),9,11,13,15-hexaene-4,6-dione.
| Compound Name | 17-hydroxy-7-methyl-2-(4-nitrophenyl)-5,7-diaza-9-azoniatetracyclo[8.7.0.03,8.011,16]heptadeca-1(17),3(8),9,11,13,15-hexaene-4,6-dione |
|---|---|
| PubChem CID | 78577815 |
| Molecular Formula | C21H15N4O5+ |
| Molecular Weight | 403.37 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | 17-hydroxy-7-methyl-2-(4-nitrophenyl)-5,7-diaza-9-azoniatetracyclo[8.7.0.03,8.011,16]heptadeca-1(17),3(8),9,11,13,15-hexaene-4,6-dione |
| SMILES | Cn1c2c(c(=O)[nH]c1=O)C(c1ccc([N+](=O)[O-])cc1)C1=C(O)c3ccccc3C1=[NH+]2 |
| InChI | InChI=1S/C21H14N4O5/c1-24-19-16(20(27)23-21(24)28)14(10-6-8-11(9-7-10)25(29)30)15-17(22-19)12-4-2-3-5-13(12)18(15)26/h2-9,14,26H,1H3,(H,23,27,28)/p+1 |
| InChIKey | XADRDOKOWVCSDS-UHFFFAOYSA-O |
| XLogP | 0.61 |
| TPSA | 132.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.37 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|