C29H24N2O5S2 — CID 78578471
(8S)-11-(4-methoxyphenyl)-8-[2-[(3-methylphenyl)methoxy]phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 78578471) has the molecular formula C29H24N2O5S2 and a molecular weight of 544.65 g/mol. Its IUPAC name is (8S)-11-(4-methoxyphenyl)-8-[2-[(3-methylphenyl)methoxy]phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | (8S)-11-(4-methoxyphenyl)-8-[2-[(3-methylphenyl)methoxy]phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 78578471 |
| Molecular Formula | C29H24N2O5S2 |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 544.11 |
| IUPAC Name | (8S)-11-(4-methoxyphenyl)-8-[2-[(3-methylphenyl)methoxy]phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | COc1ccc(N2C(=O)C3Sc4[nH]c(=O)sc4[C@H](c4ccccc4OCc4cccc(C)c4)C3C2=O)cc1 |
| InChI | InChI=1S/C29H24N2O5S2/c1-16-6-5-7-17(14-16)15-36-21-9-4-3-8-20(21)22-23-25(37-26-24(22)38-29(34)30-26)28(33)31(27(23)32)18-10-12-19(35-2)13-11-18/h3-14,22-23,25H,15H2,1-2H3,(H,30,34)/t22-,23?,25?/m1/s1 |
| InChIKey | LAYAKKXSCZVHOG-BJYSPHJKSA-N |
| XLogP | 5.13 |
| TPSA | 88.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|