C26H28N2O3 — CID 78585406
4-[(4-butoxyphenyl)methylidene]-2-ethyl-1,3-dihydrobenzo[b][1,6]naphthyridine-10-carboxylic acid (PubChem CID 78585406) has the molecular formula C26H28N2O3 and a molecular weight of 416.52 g/mol. Its IUPAC name is 4-[(4-butoxyphenyl)methylidene]-2-ethyl-1,3-dihydrobenzo[b][1,6]naphthyridine-10-carboxylic acid.
| Compound Name | 4-[(4-butoxyphenyl)methylidene]-2-ethyl-1,3-dihydrobenzo[b][1,6]naphthyridine-10-carboxylic acid |
|---|---|
| PubChem CID | 78585406 |
| Molecular Formula | C26H28N2O3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 4-[(4-butoxyphenyl)methylidene]-2-ethyl-1,3-dihydrobenzo[b][1,6]naphthyridine-10-carboxylic acid |
| SMILES | CCCCOc1ccc(C=C2CN(CC)Cc3c2nc2ccccc2c3C(=O)O)cc1 |
| InChI | InChI=1S/C26H28N2O3/c1-3-5-14-31-20-12-10-18(11-13-20)15-19-16-28(4-2)17-22-24(26(29)30)21-8-6-7-9-23(21)27-25(19)22/h6-13,15H,3-5,14,16-17H2,1-2H3,(H,29,30) |
| InChIKey | MAHFGZUTNAFAJU-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|