About 2-chloro-N-[(2-oxo-3,5-dihydrobenzimidazol-5-yl)methyl]acetamide
2-chloro-N-[(2-oxo-3,5-dihydrobenzimidazol-5-yl)methyl]acetamide (PubChem CID 78595955) has the molecular formula C10H10ClN3O2
and a molecular weight of 239.66 g/mol. Its IUPAC name is 2-chloro-N-[(2-oxo-3,5-dihydrobenzimidazol-5-yl)methyl]acetamide.
Molecular Properties
| Compound Name | 2-chloro-N-[(2-oxo-3,5-dihydrobenzimidazol-5-yl)methyl]acetamide |
| PubChem CID | 78595955 |
| Molecular Formula | C10H10ClN3O2 |
| Molecular Weight | 239.66 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | 2-chloro-N-[(2-oxo-3,5-dihydrobenzimidazol-5-yl)methyl]acetamide |
| SMILES | O=C(CCl)NCC1C=CC2=NC(=O)NC2=C1 |
| InChI | InChI=1S/C10H10ClN3O2/c11-4-9(15)12-5-6-1-2-7-8(3-6)14-10(16)13-7/h1-3,6H,4-5H2,(H,12,15)(H,14,16) |
| InChIKey | ZEPKDNZPNFYCDY-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.66 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-[(2-oxo-3,5-dihydrobenzimidazol-5-yl)methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[(2-oxo-3,5-dihydrobenzimidazol-5-yl)methyl]acetamide?
The IUPAC name of 2-chloro-N-[(2-oxo-3,5-dihydrobenzimidazol-5-yl)methyl]acetamide (CID 78595955) is 2-chloro-N-[(2-oxo-3,5-dihydrobenzimidazol-5-yl)methyl]acetamide.
What is the SMILES notation for 2-chloro-N-[(2-oxo-3,5-dihydrobenzimidazol-5-yl)methyl]acetamide?
The canonical SMILES for 2-chloro-N-[(2-oxo-3,5-dihydrobenzimidazol-5-yl)methyl]acetamide is O=C(CCl)NCC1C=CC2=NC(=O)NC2=C1.
What is the InChIKey of 2-chloro-N-[(2-oxo-3,5-dihydrobenzimidazol-5-yl)methyl]acetamide?
The InChIKey is ZEPKDNZPNFYCDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClN3O2/c11-4-9(15)12-5-6-1-2-7-8(3-6)14-10(16)13-7/h1-3,6H,4-5H2,(H,12,15)(H,14,16).
What are the key properties of 2-chloro-N-[(2-oxo-3,5-dihydrobenzimidazol-5-yl)methyl]acetamide?
2-chloro-N-[(2-oxo-3,5-dihydrobenzimidazol-5-yl)methyl]acetamide has a molecular weight of 239.66 g/mol, XLogP of 0.58, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[(2-oxo-3,5-dihydrobenzimidazol-5-yl)methyl]acetamide is sourced from PubChem (CID 78595955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).