C5H12O8P2 — CID 786
(4-hydroxy-3-methylbut-2-enyl) phosphono hydrogen phosphate (PubChem CID 786) has the molecular formula C5H12O8P2 and a molecular weight of 262.09 g/mol. Its IUPAC name is (4-hydroxy-3-methylbut-2-enyl) phosphono hydrogen phosphate.
| Compound Name | (4-hydroxy-3-methylbut-2-enyl) phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 786 |
| Molecular Formula | C5H12O8P2 |
| Molecular Weight | 262.09 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | (4-hydroxy-3-methylbut-2-enyl) phosphono hydrogen phosphate |
| SMILES | CC(=CCOP(=O)(O)OP(=O)(O)O)CO |
| InChI | InChI=1S/C5H12O8P2/c1-5(4-6)2-3-12-15(10,11)13-14(7,8)9/h2,6H,3-4H2,1H3,(H,10,11)(H2,7,8,9) |
| InChIKey | MDSIZRKJVDMQOQ-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.09 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|