C22H20ClNO3 — CID 7860046
[2-(1-benzyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl] 3-chlorobenzoate (PubChem CID 7860046) has the molecular formula C22H20ClNO3 and a molecular weight of 381.86 g/mol. Its IUPAC name is [2-(1-benzyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl] 3-chlorobenzoate.
| Compound Name | [2-(1-benzyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl] 3-chlorobenzoate |
|---|---|
| PubChem CID | 7860046 |
| Molecular Formula | C22H20ClNO3 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | [2-(1-benzyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl] 3-chlorobenzoate |
| SMILES | Cc1cc(C(=O)COC(=O)c2cccc(Cl)c2)c(C)n1Cc1ccccc1 |
| InChI | InChI=1S/C22H20ClNO3/c1-15-11-20(16(2)24(15)13-17-7-4-3-5-8-17)21(25)14-27-22(26)18-9-6-10-19(23)12-18/h3-12H,13-14H2,1-2H3 |
| InChIKey | BLQBQSLPAQYTCZ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |