C16H16N4O3S — CID 7862740
(4-oxo-4-thiophen-2-ylbutyl) 5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate (PubChem CID 7862740) has the molecular formula C16H16N4O3S and a molecular weight of 344.40 g/mol. Its IUPAC name is (4-oxo-4-thiophen-2-ylbutyl) 5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate.
| Compound Name | (4-oxo-4-thiophen-2-ylbutyl) 5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 7862740 |
| Molecular Formula | C16H16N4O3S |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | (4-oxo-4-thiophen-2-ylbutyl) 5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate |
| SMILES | Cc1cc(C)n2nc(C(=O)OCCCC(=O)c3cccs3)nc2n1 |
| InChI | InChI=1S/C16H16N4O3S/c1-10-9-11(2)20-16(17-10)18-14(19-20)15(22)23-7-3-5-12(21)13-6-4-8-24-13/h4,6,8-9H,3,5,7H2,1-2H3 |
| InChIKey | VTKHEZLYROVOEX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 86.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|