C18H13Cl2NO3 — CID 7862850
[2-(2-methyl-1H-indol-3-yl)-2-oxoethyl] 2,4-dichlorobenzoate (PubChem CID 7862850) has the molecular formula C18H13Cl2NO3 and a molecular weight of 362.21 g/mol. Its IUPAC name is [2-(2-methyl-1H-indol-3-yl)-2-oxoethyl] 2,4-dichlorobenzoate.
| Compound Name | [2-(2-methyl-1H-indol-3-yl)-2-oxoethyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 7862850 |
| Molecular Formula | C18H13Cl2NO3 |
| Molecular Weight | 362.21 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | [2-(2-methyl-1H-indol-3-yl)-2-oxoethyl] 2,4-dichlorobenzoate |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)COC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H13Cl2NO3/c1-10-17(13-4-2-3-5-15(13)21-10)16(22)9-24-18(23)12-7-6-11(19)8-14(12)20/h2-8,21H,9H2,1H3 |
| InChIKey | GLHICHUKPVWUPN-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.21 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |