About [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] cyclopropanecarboxylate
[2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] cyclopropanecarboxylate (PubChem CID 7863291) has the molecular formula C11H10Cl2N2O3
and a molecular weight of 289.12 g/mol. Its IUPAC name is [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] cyclopropanecarboxylate.
Molecular Properties
| Compound Name | [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] cyclopropanecarboxylate |
| PubChem CID | 7863291 |
| Molecular Formula | C11H10Cl2N2O3 |
| Molecular Weight | 289.12 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] cyclopropanecarboxylate |
| SMILES | O=C(COC(=O)C1CC1)Nc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C11H10Cl2N2O3/c12-7-3-8(13)10(14-4-7)15-9(16)5-18-11(17)6-1-2-6/h3-4,6H,1-2,5H2,(H,14,15,16) |
| InChIKey | XAPOCNVIQHYEPX-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.12 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] cyclopropanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] cyclopropanecarboxylate?
The IUPAC name of [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] cyclopropanecarboxylate (CID 7863291) is [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] cyclopropanecarboxylate.
What is the SMILES notation for [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] cyclopropanecarboxylate?
The canonical SMILES for [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] cyclopropanecarboxylate is O=C(COC(=O)C1CC1)Nc1ncc(Cl)cc1Cl.
What is the InChIKey of [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] cyclopropanecarboxylate?
The InChIKey is XAPOCNVIQHYEPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10Cl2N2O3/c12-7-3-8(13)10(14-4-7)15-9(16)5-18-11(17)6-1-2-6/h3-4,6H,1-2,5H2,(H,14,15,16).
What are the key properties of [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] cyclopropanecarboxylate?
[2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] cyclopropanecarboxylate has a molecular weight of 289.12 g/mol, XLogP of 2.28, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] cyclopropanecarboxylate is sourced from PubChem (CID 7863291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).