About (2-benzamido-2-oxoethyl) cyclopropanecarboxylate
(2-benzamido-2-oxoethyl) cyclopropanecarboxylate (PubChem CID 7863473) has the molecular formula C13H13NO4
and a molecular weight of 247.25 g/mol. Its IUPAC name is (2-benzamido-2-oxoethyl) cyclopropanecarboxylate.
Molecular Properties
| Compound Name | (2-benzamido-2-oxoethyl) cyclopropanecarboxylate |
| PubChem CID | 7863473 |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | (2-benzamido-2-oxoethyl) cyclopropanecarboxylate |
| SMILES | O=C(COC(=O)C1CC1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H13NO4/c15-11(8-18-13(17)10-6-7-10)14-12(16)9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,14,15,16) |
| InChIKey | MNAAPFPPOSLJCX-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-benzamido-2-oxoethyl) cyclopropanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-benzamido-2-oxoethyl) cyclopropanecarboxylate?
The IUPAC name of (2-benzamido-2-oxoethyl) cyclopropanecarboxylate (CID 7863473) is (2-benzamido-2-oxoethyl) cyclopropanecarboxylate.
What is the SMILES notation for (2-benzamido-2-oxoethyl) cyclopropanecarboxylate?
The canonical SMILES for (2-benzamido-2-oxoethyl) cyclopropanecarboxylate is O=C(COC(=O)C1CC1)NC(=O)c1ccccc1.
What is the InChIKey of (2-benzamido-2-oxoethyl) cyclopropanecarboxylate?
The InChIKey is MNAAPFPPOSLJCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO4/c15-11(8-18-13(17)10-6-7-10)14-12(16)9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,14,15,16).
What are the key properties of (2-benzamido-2-oxoethyl) cyclopropanecarboxylate?
(2-benzamido-2-oxoethyl) cyclopropanecarboxylate has a molecular weight of 247.25 g/mol, XLogP of 0.90, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-benzamido-2-oxoethyl) cyclopropanecarboxylate is sourced from PubChem (CID 7863473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).