C15H11F4NO2 — CID 786348
2-[[4-(1,1,2,2-tetrafluoroethoxy)phenyl]iminomethyl]phenol (PubChem CID 786348) has the molecular formula C15H11F4NO2 and a molecular weight of 313.25 g/mol. Its IUPAC name is 2-[[4-(1,1,2,2-tetrafluoroethoxy)phenyl]iminomethyl]phenol.
| Compound Name | 2-[[4-(1,1,2,2-tetrafluoroethoxy)phenyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 786348 |
| Molecular Formula | C15H11F4NO2 |
| Molecular Weight | 313.25 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 2-[[4-(1,1,2,2-tetrafluoroethoxy)phenyl]iminomethyl]phenol |
| SMILES | Oc1ccccc1/C=N/c1ccc(OC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C15H11F4NO2/c16-14(17)15(18,19)22-12-7-5-11(6-8-12)20-9-10-3-1-2-4-13(10)21/h1-9,14,21H/b20-9+ |
| InChIKey | SIQPSCBYYXYOIC-AWQFTUOYSA-N |
| XLogP | 4.38 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.25 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|