About 4-chloro-N-(2,2-dichloroethenyl)benzamide
4-chloro-N-(2,2-dichloroethenyl)benzamide (PubChem CID 786380) has the molecular formula C9H6Cl3NO
and a molecular weight of 250.51 g/mol. Its IUPAC name is 4-chloro-N-(2,2-dichloroethenyl)benzamide.
Molecular Properties
| Compound Name | 4-chloro-N-(2,2-dichloroethenyl)benzamide |
| PubChem CID | 786380 |
| Molecular Formula | C9H6Cl3NO |
| Molecular Weight | 250.51 g/mol |
| Exact Mass | 248.95 |
| IUPAC Name | 4-chloro-N-(2,2-dichloroethenyl)benzamide |
| SMILES | O=C(NC=C(Cl)Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H6Cl3NO/c10-7-3-1-6(2-4-7)9(14)13-5-8(11)12/h1-5H,(H,13,14) |
| InChIKey | ITZFQOUCEBIXPQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.51 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-chloro-N-(2,2-dichloroethenyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-(2,2-dichloroethenyl)benzamide?
The IUPAC name of 4-chloro-N-(2,2-dichloroethenyl)benzamide (CID 786380) is 4-chloro-N-(2,2-dichloroethenyl)benzamide.
What is the SMILES notation for 4-chloro-N-(2,2-dichloroethenyl)benzamide?
The canonical SMILES for 4-chloro-N-(2,2-dichloroethenyl)benzamide is O=C(NC=C(Cl)Cl)c1ccc(Cl)cc1.
What is the InChIKey of 4-chloro-N-(2,2-dichloroethenyl)benzamide?
The InChIKey is ITZFQOUCEBIXPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6Cl3NO/c10-7-3-1-6(2-4-7)9(14)13-5-8(11)12/h1-5H,(H,13,14).
What are the key properties of 4-chloro-N-(2,2-dichloroethenyl)benzamide?
4-chloro-N-(2,2-dichloroethenyl)benzamide has a molecular weight of 250.51 g/mol, XLogP of 3.35, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-(2,2-dichloroethenyl)benzamide is sourced from PubChem (CID 786380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).