C14H12Cl2F3NO3 — CID 7864056
[(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate (PubChem CID 7864056) has the molecular formula C14H12Cl2F3NO3 and a molecular weight of 370.15 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate.
| Compound Name | [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 7864056 |
| Molecular Formula | C14H12Cl2F3NO3 |
| Molecular Weight | 370.15 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate |
| SMILES | C[C@H](OC(=O)[C@]1(C)CC1(Cl)Cl)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H12Cl2F3NO3/c1-6(23-12(22)13(2)5-14(13,15)16)11(21)20-8-4-3-7(17)9(18)10(8)19/h3-4,6H,5H2,1-2H3,(H,20,21)/t6-,13-/m0/s1 |
| InChIKey | KJYIKGOVMMEPBA-IYQDAUBNSA-N |
| XLogP | 3.56 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.15 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|