About N-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)benzamide
N-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)benzamide (PubChem CID 786409) has the molecular formula C18H13N3OS
and a molecular weight of 319.39 g/mol. Its IUPAC name is N-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)benzamide.
Molecular Properties
| Compound Name | N-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)benzamide |
| PubChem CID | 786409 |
| Molecular Formula | C18H13N3OS |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | N-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)benzamide |
| SMILES | O=C(Nc1c(-c2ccccc2)nc2sccn12)c1ccccc1 |
| InChI | InChI=1S/C18H13N3OS/c22-17(14-9-5-2-6-10-14)20-16-15(13-7-3-1-4-8-13)19-18-21(16)11-12-23-18/h1-12H,(H,20,22) |
| InChIKey | MCSIZAMXJUWZDC-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)benzamide?
The IUPAC name of N-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)benzamide (CID 786409) is N-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)benzamide.
What is the SMILES notation for N-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)benzamide?
The canonical SMILES for N-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)benzamide is O=C(Nc1c(-c2ccccc2)nc2sccn12)c1ccccc1.
What is the InChIKey of N-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)benzamide?
The InChIKey is MCSIZAMXJUWZDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13N3OS/c22-17(14-9-5-2-6-10-14)20-16-15(13-7-3-1-4-8-13)19-18-21(16)11-12-23-18/h1-12H,(H,20,22).
What are the key properties of N-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)benzamide?
N-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)benzamide has a molecular weight of 319.39 g/mol, XLogP of 4.32, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)benzamide is sourced from PubChem (CID 786409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).