About [2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl] 2-fluorobenzoate
[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl] 2-fluorobenzoate (PubChem CID 7864282) has the molecular formula C18H16FNO3
and a molecular weight of 313.33 g/mol. Its IUPAC name is [2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl] 2-fluorobenzoate.
Molecular Properties
| Compound Name | [2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl] 2-fluorobenzoate |
| PubChem CID | 7864282 |
| Molecular Formula | C18H16FNO3 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | [2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl] 2-fluorobenzoate |
| SMILES | O=C(OCC(=O)N1CCc2ccccc2C1)c1ccccc1F |
| InChI | InChI=1S/C18H16FNO3/c19-16-8-4-3-7-15(16)18(22)23-12-17(21)20-10-9-13-5-1-2-6-14(13)11-20/h1-8H,9-12H2 |
| InChIKey | DKPFGQLVQHDDKZ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl] 2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl] 2-fluorobenzoate?
The IUPAC name of [2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl] 2-fluorobenzoate (CID 7864282) is [2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl] 2-fluorobenzoate.
What is the SMILES notation for [2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl] 2-fluorobenzoate?
The canonical SMILES for [2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl] 2-fluorobenzoate is O=C(OCC(=O)N1CCc2ccccc2C1)c1ccccc1F.
What is the InChIKey of [2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl] 2-fluorobenzoate?
The InChIKey is DKPFGQLVQHDDKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16FNO3/c19-16-8-4-3-7-15(16)18(22)23-12-17(21)20-10-9-13-5-1-2-6-14(13)11-20/h1-8H,9-12H2.
What are the key properties of [2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl] 2-fluorobenzoate?
[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl] 2-fluorobenzoate has a molecular weight of 313.33 g/mol, XLogP of 2.57, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl] 2-fluorobenzoate is sourced from PubChem (CID 7864282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).