About 3-amino-4-phenyl-1H-1,2,4-triazole-5-thione
3-amino-4-phenyl-1H-1,2,4-triazole-5-thione (PubChem CID 786455) has the molecular formula C8H8N4S
and a molecular weight of 192.25 g/mol. Its IUPAC name is 3-amino-4-phenyl-1H-1,2,4-triazole-5-thione.
Molecular Properties
| Compound Name | 3-amino-4-phenyl-1H-1,2,4-triazole-5-thione |
| PubChem CID | 786455 |
| Molecular Formula | C8H8N4S |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 3-amino-4-phenyl-1H-1,2,4-triazole-5-thione |
| SMILES | Nc1n[nH]c(=S)n1-c1ccccc1 |
| InChI | InChI=1S/C8H8N4S/c9-7-10-11-8(13)12(7)6-4-2-1-3-5-6/h1-5H,(H2,9,10)(H,11,13) |
| InChIKey | CBILWXOSKBQRGX-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 59.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-4-phenyl-1H-1,2,4-triazole-5-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4-phenyl-1H-1,2,4-triazole-5-thione?
The IUPAC name of 3-amino-4-phenyl-1H-1,2,4-triazole-5-thione (CID 786455) is 3-amino-4-phenyl-1H-1,2,4-triazole-5-thione.
What is the SMILES notation for 3-amino-4-phenyl-1H-1,2,4-triazole-5-thione?
The canonical SMILES for 3-amino-4-phenyl-1H-1,2,4-triazole-5-thione is Nc1n[nH]c(=S)n1-c1ccccc1.
What is the InChIKey of 3-amino-4-phenyl-1H-1,2,4-triazole-5-thione?
The InChIKey is CBILWXOSKBQRGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4S/c9-7-10-11-8(13)12(7)6-4-2-1-3-5-6/h1-5H,(H2,9,10)(H,11,13).
What are the key properties of 3-amino-4-phenyl-1H-1,2,4-triazole-5-thione?
3-amino-4-phenyl-1H-1,2,4-triazole-5-thione has a molecular weight of 192.25 g/mol, XLogP of 1.51, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-phenyl-1H-1,2,4-triazole-5-thione is sourced from PubChem (CID 786455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).