C17H12N4O6 — CID 7866102
[2-oxo-2-[(5-phenyl-1,3,4-oxadiazol-2-yl)amino]ethyl] 3-nitrobenzoate (PubChem CID 7866102) has the molecular formula C17H12N4O6 and a molecular weight of 368.31 g/mol. Its IUPAC name is [2-oxo-2-[(5-phenyl-1,3,4-oxadiazol-2-yl)amino]ethyl] 3-nitrobenzoate.
| Compound Name | [2-oxo-2-[(5-phenyl-1,3,4-oxadiazol-2-yl)amino]ethyl] 3-nitrobenzoate |
|---|---|
| PubChem CID | 7866102 |
| Molecular Formula | C17H12N4O6 |
| Molecular Weight | 368.31 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | [2-oxo-2-[(5-phenyl-1,3,4-oxadiazol-2-yl)amino]ethyl] 3-nitrobenzoate |
| SMILES | O=C(COC(=O)c1cccc([N+](=O)[O-])c1)Nc1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C17H12N4O6/c22-14(10-26-16(23)12-7-4-8-13(9-12)21(24)25)18-17-20-19-15(27-17)11-5-2-1-3-6-11/h1-9H,10H2,(H,18,20,22) |
| InChIKey | FSWZZCCNHXHSCR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.31 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|