C26H22N2O3 — CID 7866906
[(2S)-1-(3-methylanilino)-1-oxopropan-2-yl] 2-phenylquinoline-4-carboxylate (PubChem CID 7866906) has the molecular formula C26H22N2O3 and a molecular weight of 410.47 g/mol. Its IUPAC name is [(2S)-1-(3-methylanilino)-1-oxopropan-2-yl] 2-phenylquinoline-4-carboxylate.
| Compound Name | [(2S)-1-(3-methylanilino)-1-oxopropan-2-yl] 2-phenylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 7866906 |
| Molecular Formula | C26H22N2O3 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | [(2S)-1-(3-methylanilino)-1-oxopropan-2-yl] 2-phenylquinoline-4-carboxylate |
| SMILES | Cc1cccc(NC(=O)[C@H](C)OC(=O)c2cc(-c3ccccc3)nc3ccccc23)c1 |
| InChI | InChI=1S/C26H22N2O3/c1-17-9-8-12-20(15-17)27-25(29)18(2)31-26(30)22-16-24(19-10-4-3-5-11-19)28-23-14-7-6-13-21(22)23/h3-16,18H,1-2H3,(H,27,29)/t18-/m0/s1 |
| InChIKey | ZAZHJMBYKGRQFB-SFHVURJKSA-N |
| XLogP | 5.39 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |